RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0708 |
| Common Name | Ferulate |
| Synonyms Names | Ferulic acid ;4-Hydroxy-3-methoxycinnamic acid ;3-Methoxy-4-hydroxy-trans-cinnamate |
| Formula | C10H10O4 |
| Formula at pH 7.2 (Predicted) | C10H9O4- |
| Molecular Weight | 194.184 |
| Structure |  |
| SMILES | C(O)(=O)C=Cc1(cc(OC)c(O)cc1) |
| Reactions | OSR1178 OSR1837 OSR1953 OSR2002 OSR2686 |
| Pathways | |
|---|---|
| KEGG | rn00940 rn01100 rn01110 |
| Metacyc | PWY-2181 PWY-1121 |
| Database Links | |
|---|---|
| KEGG | C01494 |
| ChEBI | 17620 |