RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0709 |
| Common Name | Tryptamine |
| Synonyms Names | 3-(2-Aminoethyl)indole |
| Formula | C10H12N2 |
| Formula at pH 7.2 (Predicted) | C10H13N2+ |
| Molecular Weight | 160.216 |
| Structure |  |
| SMILES | C(N)Cc1(c2(c([nH]c1)cccc2)) |
| Reactions | OSR0348 OSR0382 OSR1301 OSR1987 |
| Pathways | |
|---|---|
| KEGG | rn00380 |
| Metacyc | PWY-5290 PWY-581 |
| Database Links | |
|---|---|
| KEGG | C00398 |
| ChEBI | 16765 |
| Pubchem Compound | 1150 |
| Pubchem Substance | 3688 |