RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0711 |
| Common Name | D-Glucarate |
| Synonyms Names | D-Glucaric acid ;L-Gularic acid ;D-Saccharic acid ;D-Glucosaccharic acid |
| Formula | C6H10O8 |
| Formula at pH 7.2 (Predicted) | C6H8O82- |
| Molecular Weight | 210.139 |
| Structure |  |
| SMILES | OC(C(C(=O)O)O)C(C(C(=O)O)O)O |
| Reactions | OSR1803 |
| Pathways | |
|---|---|
| KEGG | rn00053 rn01100 |
| Database Links | |
|---|---|
| KEGG | C00818 |
| ChEBI | 16002 |
| Pubchem Compound | 33037 |
| Pubchem Substance | 4076 |