RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0712 |
| Common Name | myo-Inositol |
| Synonyms Names | D-myo-Inositol ;1D-myo-Inositol ;L-myo-Inositol ;1L-myo-Inositol ;meso-Inositol ;Inositol ;Dambose ;Cyclohexitol ;Meat sugar ;Bios I |
| Formula | C6H12O6 |
| Formula at pH 7.2 (Predicted) | C6H12O6 |
| Molecular Weight | 180.156 |
| Structure |  |
| SMILES | C1(C(O)C(O)C(O)C(O)C(O)1)(O) |
| Reactions | OSR0449 OSR0458 OSR0465 OSR0746 OSR1122 OSR1204 OSR1218 OSR1226 OSR1228 OSR1233 OSR1312 OSR1392 OSR1490 OSR1717 OSR2117 OSR2508 |
| Pathways | |
|---|---|
| KEGG | rn00562 rn01100 rn00521 rn01110 rn00052 rn00053 rn00564 |
| Metacyc | PWY-5338 PWY-4841 PHOSLIPSYN2-PWY PWY-5337 |
| Database Links | |
|---|---|
| KEGG | C00137 |
| ChEBI | 17268 |