RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0719 |
| Common Name | L-Galactose |
| Synonyms Names | L-galactose |
| Formula | C6H12O6 |
| Formula at pH 7.2 (Predicted) | C18H32O16 |
| Molecular Weight | 180.156 |
| Structure |  |
| SMILES | C(O)C1(OC(C(O)C(O)C(O)1)OC2(C(O)C(O)C(O2)CO)COC3(OC(CO)C(O)C(O)3)(CO)) |
| Reactions | OSR0454 OSR1147 OSR1762 OSR1772 |
| Pathways | |
|---|---|
| KEGG | rn00053 rn01100 rn01110 |
| Database Links | |
|---|---|
| KEGG | C01825 |
| ChEBI | 42905 |
| Pubchem Compound | 439583 |
| Pubchem Substance | 4948 |