RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0721 |
| Common Name | alpha-D-galactose |
| Formula | C6H12O6 |
| Formula at pH 7.2 (Predicted) | C6H12O6 |
| Molecular Weight | 180.157 |
| Structure |  |
| SMILES | O[C@H]1[C@@H](O)[C@H](O[C@H](O)[C@@H]1O)CO |
| Reactions | OSR0264 OSR0599 OSR0742 OSR1159 OSR1208 OSR1398 OSR2195 OSR2242 |
| Pathways | |
|---|---|
| KEGG | rn00052 rn00561 rn00603 rn00600 |
| Metacyc | PWY0-1301 PWY-6527 |