RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0722 |
| Common Name | beta-D-Glucose |
| Formula | C6H12O6 |
| Formula at pH 7.2 (Predicted) | C6H12O6 |
| Molecular Weight | 180.156 |
| Structure |  |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)O)O)O)O |
| Reactions | OSR0267 OSR0514 OSR0523 OSR0610 OSR0631 OSR0718 OSR1199 OSR1416 OSR2181 |
| Pathways | |
|---|---|
| KEGG | rn00010 rn01110 rn01120 rn00500 rn01100 rn00460 rn00940 |
| Metacyc | PWY-5176 PWY-4441 PWY-3121 PWY-6002 |
| Database Links | |
|---|---|
| KEGG | C00221 |
| ChEBI | 15903 |
| Pubchem Compound | 64689 |
| Pubchem Substance | 3521 |