RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0730 |
| Common Name | homocitrate |
| Formula | C7H10O7 |
| Formula at pH 7.2 (Predicted) | C7H7O73- |
| Molecular Weight | 206.152 |
| Structure |  |
| SMILES | OC(=O)CCC(C(=O)O)(CC(=O)O)O |
| Reactions | OSR0282 OSR2063 |
| Pathways | |
|---|---|
| Metacyc | LYSINE-AMINOAD-PWY |