RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0732 |
| Common Name | alpha-Isopropylmalate |
| Synonyms Names | (2S)-2-Isopropylmalate ;(2S)-2-Hydroxy-2-isopropylsuccinic acid ;2-Isopropylmalic acid ;3-Carboxy-3-hydroxy-4-methylpentanoate ;3-Carboxy-3-hydroxyisocaproate |
| Formula | C7H12O5 |
| Formula at pH 7.2 (Predicted) | C7H10O52- |
| Molecular Weight | 176.167 |
| Structure |  |
| SMILES | C(=O)(O)CC(O)(C(=O)O)C(C)C |
| Reactions | OSR0259 OSR0281 OSR2069 |
| Pathways | |
|---|---|
| KEGG | rn00290 rn01100 rn01110 rn01210 rn00620 |
| Metacyc | LEUSYN-PWY |
| Database Links | |
|---|---|
| KEGG | C02504 |