RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0752 |
| Common Name | L-Tyrosine |
| Synonyms Names | (S)-3-(p-Hydroxyphenyl)alanine ;(S)-2-Amino-3-(p-hydroxyphenyl)propionic acid ;Tyrosine |
| Formula | C9H11NO3 |
| Formula at pH 7.2 (Predicted) | C9H11NO3 |
| Molecular Weight | 181.189 |
| Structure |  |
| SMILES | C(=O)(O)C(N)Cc1(ccc(O)cc1) |
| Reactions | OSR0271 OSR0288 OSR0627 OSR0986 OSR1271 OSR1530 OSR2767 OSR2932 |
| Pathways | |
|---|---|
| KEGG | rn00940 rn00130 rn00350 rn00400 rn00401 rn00950 rn01100 rn01110 rn00970 |
| Metacyc | TYRFUMCAT-PWY PWY-3581 PWY-6133 PWY-5474 PWY-5254 TRNA-CHARGING-PWY |
| Database Links | |
|---|---|
| KEGG | C00082 |
| ChEBI | 17895 |