RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0761 |
| Common Name | 5-Hydroxyferulate |
| Formula | C10H10O5 |
| Formula at pH 7.2 (Predicted) | C10H9O5- |
| Molecular Weight | 210.183 |
| Structure |  |
| SMILES | C(O)(=O)C=Cc1(cc(OC)c(O)c(O)c1) |
| Reactions | OSR1266 OSR2002 OSR2701 |
| Pathways | |
|---|---|
| KEGG | rn00940 rn01100 rn01110 |
| Metacyc | PWY-2181 |
| Database Links | |
|---|---|
| KEGG | C05619 |
| Pubchem Compound | 446834 |
| Pubchem Substance | 7937 |