RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0771 |
| Common Name | cis-1,2-Dihydroxy-1,2-dihydro-8-carboxynaphthalene |
| Formula | C11H10O4 |
| Formula at pH 7.2 (Predicted) | C11H9O4- |
| Molecular Weight | 206.195 |
| Structure |  |
| SMILES | OC1C=Cc2c(C1O)c(ccc2)C(=O)O |
| Reactions | OSR0270 |
| Pathways | |
|---|---|
| KEGG | rn00626 rn01120 |
| Database Links | |
|---|---|
| KEGG | C14092 |
| Pubchem Compound | 656872 |
| Pubchem Substance | 854328 |