RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0776 |
| Common Name | Quinate |
| Synonyms Names | Quinic acid ;Kinic acid ;Chinic acid ;L-Quinic acid ;L-Quinate ;(-)-Quinic acid |
| Formula | C7H12O6 |
| Formula at pH 7.2 (Predicted) | C7H11O6- |
| Molecular Weight | 192.167 |
| Structure |  |
| SMILES | C(=O)(O)C1([CH2][CH](O)[CH](O)[CH](O)[CH2]1)(O) |
| Reactions | OSR0936 OSR2338 OSR2355 |
| Pathways | |
|---|---|
| KEGG | rn00940 rn00941 rn00945 rn01110 |
| Database Links | |
|---|---|
| KEGG | C00296 |