RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0781 |
| Common Name | N-Hydroxyl-tryptamine |
| Formula | C10H12N2O |
| Formula at pH 7.2 (Predicted) | C10H12N2O |
| Molecular Weight | 176.215 |
| Structure |  |
| SMILES | c1(c(CCNO)c2(c([nH]1)cccc2)) |
| Reactions | OSR0260 OSR1987 |
| Pathways | |
|---|---|
| KEGG | rn00380 |
| Metacyc | PWY-581 |
| Database Links | |
|---|---|
| KEGG | C17203 |
| Pubchem Compound | 13571630 |
| Pubchem Substance | 96023612 |