RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0786 |
| Common Name | alpha-D-Ribose 1-phosphate |
| Synonyms Names | Ribose 1-phosphate ;D-Ribose 1-phosphate |
| Formula | C5H11O8P |
| Formula at pH 7.2 (Predicted) | C5H9O8P2- |
| Molecular Weight | 230.11 |
| Structure |  |
| SMILES | C(O)[CH]1(O[CH](OP(O)(O)=O)[CH](O)[CH](O)1) |
| Reactions | OSR0295 OSR0555 OSR0601 OSR0630 OSR0639 OSR0654 |
| Pathways | |
|---|---|
| KEGG | rn00030 rn00230 |
| Database Links | |
|---|---|
| KEGG | C00620 |
| ChEBI | 35425 |
| Pubchem Compound | 439236 |
| Pubchem Substance | 3894 |