RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0789 |
| Common Name | beta-L-Arabinose 1-phosphate |
| Formula | C5H11O8P |
| Formula at pH 7.2 (Predicted) | C5H9O8P2- |
| Molecular Weight | 230.11 |
| Structure |  |
| SMILES | C1(OC(OP(O)(=O)O)C(O)C(O)C(O)1) |
| Reactions | OSR1115 OSR1153 |
| Pathways | |
|---|---|
| KEGG | rn00520 rn01100 rn01110 |
| Database Links | |
|---|---|
| Gramene | CPD-1825 |
| KEGG | C03906 |
| ChEBI | 15807 |
| Pubchem Compound | 440160 |
| Pubchem Substance | 6637 |