RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0798 |
| Common Name | 1,3,7-Trimethyluric acid |
| Formula | C8H10N4O3 |
| Formula at pH 7.2 (Predicted) | C8H10N4O3 |
| Molecular Weight | 210.19 |
| Structure |  |
| SMILES | Cn1c(=O)[nH]c2c1c(=O)n(c(=O)n2C)C |
| Reactions | OSR0447 |
| Pathways | |
|---|---|
| KEGG | rn00232 rn01120 |
| Database Links | |
|---|---|
| KEGG | C16361 |
| ChEBI | 691622 |
| Pubchem Compound | 79437 |
| Pubchem Substance | 47205669 |