RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0801 |
| Common Name | 3,4-Dihydroxy-L-phenylalanine |
| Synonyms Names | L-Dopa ;3-Hydroxy-L-tyrosine ;L-beta-(3,4-Dihydroxyphenyl)alanine ;Levodopa ;Dihydroxy-L-phenylalanine |
| Formula | C9H11NO4 |
| Formula at pH 7.2 (Predicted) | C9H11NO4 |
| Molecular Weight | 197.188 |
| Structure |  |
| SMILES | C(=O)(O)C(N)Cc1(ccc(O)c(O)c1) |
| Reactions | OSR0288 OSR0297 OSR0986 |
| Pathways | |
|---|---|
| KEGG | rn00350 rn00950 rn00965 rn01100 rn01110 |
| Database Links | |
|---|---|
| KEGG | C00355 |
| ChEBI | 15765 |