RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0804 |
| Common Name | 2,3-Diketo-5-methylthiopentyl-1-phosphate |
| Synonyms Names | 5-(Methylthio)-2,3-dioxopentyl phosphate |
| Formula | C6H11O6PS |
| Formula at pH 7.2 (Predicted) | C6H9O6PS2- |
| Molecular Weight | 242.187 |
| Structure |  |
| SMILES | C(SC)CC(=O)C(=O)COP(O)(=O)O |
| Reactions | OSR0290 OSR0357 OSR0366 |
| Pathways | |
|---|---|
| KEGG | rn00270 |
| Database Links | |
|---|---|
| Gramene | CPD-84 |
| KEGG | C15650 |
| ChEBI | 50604 |
| Pubchem Compound | 561 |
| Pubchem Substance | 17396640 |