RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0806 |
| Common Name | 2-Acyl-1-(1-alkenyl)-sn-glycero-3-phosphate |
| Synonyms Names | C15647 |
| Formula | C6H9O7PR2 |
| Formula at pH 7.2 (Predicted) | C6H7O7P1R2 |
| Structure |  |
| SMILES | O[P](O)(=O)OCC(COC=C[R])OC(=O)[R] |
| Reactions | OSR0527 |
| Pathways | |
|---|---|
| KEGG | rn00565 |
| Database Links | |
|---|---|
| KEGG | C15647 |
| Pubchem Substance | 17396637 |