RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0823 |
| Common Name | Prephenate |
| Synonyms Names | Prephenic acid |
| Formula | C10H10O6 |
| Formula at pH 7.2 (Predicted) | C10H8O62- |
| Molecular Weight | 226.183 |
| Structure |  |
| SMILES | C(=O)(O)C(=O)CC1(C(O)=O)(C=C[CH](O)C=C1) |
| Reactions | OSR0314 OSR0316 OSR1949 |
| Pathways | |
|---|---|
| KEGG | rn01110 rn01100 rn00400 |
| Metacyc | PHESYN PWY-3462 |
| Database Links | |
|---|---|
| KEGG | C00254 |
| ChEBI | 16666 |