RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0834 |
| Common Name | D-Sorbitol |
| Synonyms Names | D-Glucitol ;L-Gulitol ;Sorbitol |
| Formula | C6H14O6 |
| Formula at pH 7.2 (Predicted) | C6H14O6 |
| Molecular Weight | 182.172 |
| Structure |  |
| SMILES | O[C@@H]([C@@H](O)CO)[C@H](O)[C@H](O)CO |
| Reactions | OSR0798 OSR1830 |
| Pathways | |
|---|---|
| KEGG | rn00052 rn00051 rn01100 |
| Database Links | |
|---|---|
| KEGG | C00794 |
| ChEBI | 17924 |
| Pubchem Compound | 5780 |
| Pubchem Substance | 4052 |