RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0842 |
| Common Name | Isopentenyl diphosphate |
| Synonyms Names | delta3-Isopentenyl diphosphate ;delta3-Methyl-3-butenyl diphosphate |
| Formula | C5H12O7P2 |
| Formula at pH 7.2 (Predicted) | C5H10O7P22- |
| Molecular Weight | 246.092 |
| Structure |  |
| SMILES | CC(=C)CCOP(O)(=O)OP(O)(=O)O |
| Reactions | OSR0320 OSR0831 OSR1080 OSR1360 OSR1372 OSR1382 OSR1505 OSR1506 OSR1825 OSR1906 OSR1979 OSR2021 OSR2101 OSR2234 OSR2264 OSR2265 OSR2524 OSR2804 |
| Pathways | |
|---|---|
| KEGG | rn00900 rn01100 rn01110 |
| Metacyc | PWY-922 NONMEVIPP-PWY POLYISOPRENSYN-PWY PWY-5123 PWY-5121 PWY-5122 PWY-5805 |
| Database Links | |
|---|---|
| KEGG | C00129 |
| ChEBI | 16584 |