RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0844 |
| Common Name | 2-C-Methyl-D-erythritol 4-phosphate |
| Formula | C5H13O7P |
| Formula at pH 7.2 (Predicted) | C5H11O7P2- |
| Molecular Weight | 216.126 |
| Structure |  |
| SMILES | C(OP(O)(=O)O)C(O)C(O)(C)CO |
| Reactions | OSR1211 OSR2654 |
| Pathways | |
|---|---|
| KEGG | rn00900 rn01100 rn01110 |
| Metacyc | NONMEVIPP-PWY |
| Database Links | |
|---|---|
| KEGG | C11434 |
| ChEBI | 17764 |