RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0846 |
| Common Name | 3,6,8-Trimethylallantoin |
| Formula | C7H12N4O3 |
| Formula at pH 7.2 (Predicted) | C7H11N4O3- |
| Molecular Weight | 200.195 |
| Structure |  |
| SMILES | CNC(=O)N(C1NC(=O)N(C1=O)C)C |
| Reactions | OSR0447 |
| Pathways | |
|---|---|
| KEGG | rn00232 rn01120 |
| Database Links | |
|---|---|
| KEGG | C16362 |
| Pubchem Compound | 181740 |
| Pubchem Substance | 47205670 |