RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0858 |
| Common Name | 5-Phosphoribosylamine |
| Synonyms Names | 5-Phospho-beta-D-ribosylamine ;5-Phospho-D-ribosylamine ;5-Phosphoribosyl-1-amine |
| Formula | C5H12NO7P |
| Formula at pH 7.2 (Predicted) | C5H11NO7P- |
| Molecular Weight | 229.125 |
| Structure |  |
| SMILES | C(OP(O)(=O)O)[CH]1([CH](O)[CH](O)[CH](O1)N) |
| Reactions | OSR1467 OSR2070 |
| Pathways | |
|---|---|
| KEGG | rn00230 rn01100 rn01110 rn00250 |
| Metacyc | DENOVOPURINE2-PWY PWY-841 |
| Database Links | |
|---|---|
| KEGG | C03090 |
| ChEBI | 37737 |