RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0859 |
| Common Name | Choline phosphate |
| Synonyms Names | Phosphorylcholine ;Phosphocholine ;O-Phosphocholine |
| Formula | C5H15NO4P |
| Formula at pH 7.2 (Predicted) | C5H13NO4P- |
| Molecular Weight | 184.151 |
| Structure |  |
| SMILES | C[N+](C)(C)CCO[P](O)(O)=O |
| Reactions | OSR0401 OSR0682 OSR0683 OSR1144 OSR1187 OSR1216 |
| Pathways | |
|---|---|
| KEGG | rn00564 rn01100 |
| Metacyc | PHOSLIPSYN2-PWY PWY-3561 PWY-3385 |
| Database Links | |
|---|---|
| KEGG | C00588 |
| ChEBI | 18132 |