RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0860 |
| Common Name | D-erythro-1-(Imidazol-4-yl)glycerol 3-phosphate |
| Synonyms Names | D-erythro-Imidazole-glycerol 3-phosphate ;D-erythro-Imidazole-glycerol phosphate |
| Formula | C6H11N2O6P |
| Formula at pH 7.2 (Predicted) | C6H9N2O6P2- |
| Molecular Weight | 238.135 |
| Structure |  |
| SMILES | C(OP(O)(=O)O)C(O)C(O)c1(c[nH]cn1) |
| Reactions | OSR1318 OSR1441 |
| Pathways | |
|---|---|
| KEGG | rn00340 rn01100 rn01110 |
| Metacyc | HISTSYN-PWY |
| Database Links | |
|---|---|
| KEGG | C04666 |
| ChEBI | 17805 |