RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0862 |
| Common Name | L-Histidinol phosphate |
| Formula | C6H12N3O4P |
| Formula at pH 7.2 (Predicted) | C6H11N3O4P- |
| Molecular Weight | 221.151 |
| Structure |  |
| SMILES | c1(c(nc[nH]1)CC(N)COP(O)(O)=O) |
| Reactions | OSR0397 OSR0663 |
| Pathways | |
|---|---|
| KEGG | rn00340 rn01100 rn01110 |
| Metacyc | HISTSYN-PWY |
| Database Links | |
|---|---|
| KEGG | C01100 |
| ChEBI | 16996 |