RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0863 |
| Common Name | 5-L-Glutamyl amino acid |
| Synonyms Names | L-gamma-Glutamyl amino acid ;C03363 |
| Formula | C7H11N2O5R |
| Formula at pH 7.2 (Predicted) | C7H1O5N2R1- |
| Structure |  |
| SMILES | NC(CCC(=O)NC(C(O)=O)[R])C(O)=O |
| Reactions | OSR1896 |
| Pathways | |
|---|---|
| KEGG | rn00590 rn01100 |
| Database Links | |
|---|---|
| KEGG | C03363 |
| Pubchem Substance | 6200 |