RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0864 |
| Common Name | L-gamma-Glutamyl-L-amino acid |
| Synonyms Names | (5-L-Glutamyl)-L-amino acid ;C03740 ;(5-L-glutamyl)-L-amino acid |
| Formula | C7H11N2O5R |
| Formula at pH 7.2 (Predicted) | C7H1O5N2R1 |
| Structure |  |
| SMILES | NC(CCC(=O)NC(C(O)=O)[R])C(O)=O |
| Reactions | OSR0311 OSR0734 OSR0737 OSR1373 |
| Pathways | |
|---|---|
| KEGG | rn00480 |
| Metacyc | PWY-4041 |
| Database Links | |
|---|---|
| KEGG | C03740 |
| Pubchem Substance | 6503 |