RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0885 |
| Common Name | 4-Hydroxyphenyl-4-hydroxybenzoate |
| Formula | C13H10O4 |
| Formula at pH 7.2 (Predicted) | C13H10O4 |
| Molecular Weight | 230.216 |
| Structure |  |
| SMILES | Oc1ccc(cc1)OC(=O)c1ccc(cc1)O |
| Reactions | OSR0337 |
| Pathways | |
|---|---|
| KEGG | rn00363 rn01120 |
| Database Links | |
|---|---|
| KEGG | C18216 |
| Pubchem Compound | 6426651 |
| Pubchem Substance | 103061398 |