RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0900 |
| Common Name | L-Tryptophan |
| Synonyms Names | Tryptophan ;(S)-alpha-Amino-beta-(3-indolyl)-propionic acid |
| Formula | C11H12N2O2 |
| Formula at pH 7.2 (Predicted) | C11H12N2O2 |
| Molecular Weight | 204.225 |
| Structure |  |
| SMILES | c1(c(CC(N)C(=O)O)c2(c([nH]1)cccc2)) |
| Reactions | OSR0348 OSR0371 OSR0379 OSR0395 OSR0398 OSR0422 OSR0676 OSR0729 OSR2033 OSR2780 |
| Pathways | |
|---|---|
| KEGG | rn00400 rn01100 rn01110 rn00260 rn00970 |
| Metacyc | TRPSYN-PWY TRNA-CHARGING-PWY |
| Database Links | |
|---|---|
| KEGG | C00078 |
| ChEBI | 16828 |