RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0902 |
| Common Name | D-Glucono-1,5-lactone 6-phosphate |
| Synonyms Names | 6-Phospho-D-glucono-1,5-lactone |
| Formula | C6H11O9P |
| Formula at pH 7.2 (Predicted) | C6H9O9P2- |
| Molecular Weight | 258.12 |
| Structure |  |
| SMILES | C1(OC(COP(O)(=O)O)C(O)C(O)C(O)1)(=O) |
| Reactions | OSR1404 OSR2023 |
| Pathways | |
|---|---|
| KEGG | rn00030 rn01100 rn01110 rn01120 rn00480 |
| Metacyc | OXIDATIVEPENT-PWY |
| Database Links | |
|---|---|
| KEGG | C01236 |
| ChEBI | 16938 |