RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0904 |
| Common Name | (R)-5-Phosphomevalonate |
| Synonyms Names | (R)-5-Phosphomevaloonic acid ;(R)-Mevalonic acid 5-phosphate |
| Formula | C6H13O7P |
| Formula at pH 7.2 (Predicted) | C6H10O7P3- |
| Molecular Weight | 228.137 |
| Structure |  |
| SMILES | CC(O)(CC(O)=O)CCOP(O)(O)=O |
| Reactions | OSR1163 OSR1263 |
| Pathways | |
|---|---|
| KEGG | rn00900 rn01100 rn01110 |
| Metacyc | PWY-922 |
| Database Links | |
|---|---|
| Gramene | CPD-499 |
| KEGG | C01107 |
| ChEBI | 17436 |
| Pubchem Compound | 439400 |
| Pubchem Substance | 4339 |