RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0906 |
| Common Name | Shikimate 3-phosphate |
| Synonyms Names | Shikimate 5-phosphate ;3-phosphoshikimate |
| Formula | C7H11O8P |
| Formula at pH 7.2 (Predicted) | C7H8O8P3- |
| Molecular Weight | 254.131 |
| Structure |  |
| SMILES | C(O)(=O)C1(=[CH][CH]([CH](O)[CH]([CH2]1)O)OP(O)(O)=O) |
| Reactions | OSR1149 OSR1687 |
| Pathways | |
|---|---|
| KEGG | rn00400 rn01100 rn01110 |
| Metacyc | ARO-PWY PWY-6163 |
| Database Links | |
|---|---|
| KEGG | C03175 |
| ChEBI | 17052 |