RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0908 |
| Common Name | LL-2,6-Diaminoheptanedioate |
| Synonyms Names | LL-2,6-Diaminopimelate ;LL-2,6-Diaminopimelic acid |
| Formula | C7H14N2O4 |
| Formula at pH 7.2 (Predicted) | C7H14N2O4 |
| Molecular Weight | 190.197 |
| Structure |  |
| SMILES | C(O)(=O)C(N)CCCC(N)C(=O)O |
| Reactions | OSR0347 OSR0498 OSR0650 OSR0675 |
| Pathways | |
|---|---|
| KEGG | rn00300 rn01100 rn01110 rn01120 |
| Metacyc | DAPLYSINESYN-PWY PWY-5097 PWY-2941 |
| Database Links | |
|---|---|
| KEGG | C00666 |
| ChEBI | 16026 |