RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0916 |
| Common Name | isopentenyladenine |
| Formula | C10H13N5 |
| Formula at pH 7.2 (Predicted) | C10H13N5 |
| Molecular Weight | 202.238 |
| Structure |  |
| SMILES | CC(=CCNC1=NC=NC2=C1NC=N2)C |
| Reactions | OSR0414 OSR0749 OSR0889 OSR1569 OSR1579 OSR2233 |
| Pathways | |
|---|---|
| KEGG | rn00908 |
| Metacyc | PWY-2681 PWY-2901 PWY-2881 PWY-2841 |
| Database Links | |
|---|---|
| Gramene | CPD-4209 |