RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0917 |
| Common Name | N6-(delta2-Isopentenyl)-adenine |
| Synonyms Names | N6-(3-Methylbut-2-enyl)adenine ;6-(gamma,gamma-Dimethylallylamino)purine ;N6-Dimethylallyladenine ;N6-dimethylallyladenine |
| Formula | C10H13N5 |
| Formula at pH 7.2 (Predicted) | C10H12N5 |
| Molecular Weight | 203.244 |
| Structure |  |
| SMILES | c2(ncnc1(c(ncn1)2))(NCC=C(C)C) |
| Reactions | OSR1454 |
| Pathways | |
|---|---|
| KEGG | rn00908 |
| Database Links | |
|---|---|
| Gramene | CPD-4209 |
| KEGG | C04083 |
| ChEBI | 17660 |