RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0921 |
| Common Name | Sinapate |
| Synonyms Names | Sinapic acid ;3,5-Dimethoxy-4-hydroxycinnamic acid |
| Formula | C11H12O5 |
| Formula at pH 7.2 (Predicted) | C11H11O5- |
| Molecular Weight | 224.21 |
| Structure |  |
| SMILES | C(O)(=O)C=CC1(=CC(OC)=C(O)C(=C1)OC) |
| Reactions | OSR1266 OSR1940 OSR2053 OSR2747 |
| Pathways | |
|---|---|
| KEGG | rn00940 rn01100 rn01110 |
| Database Links | |
|---|---|
| KEGG | C00482 |
| ChEBI | 15714 |
| Pubchem Compound | 637775 |
| Pubchem Substance | 3765 |