RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0923 |
| Common Name | Bis(4-hydroxyphenyl)methanol |
| Formula | C13H12O3 |
| Formula at pH 7.2 (Predicted) | C13H12O3 |
| Molecular Weight | 216.233 |
| Structure |  |
| SMILES | OC(c1ccc(cc1)O)c1ccc(cc1)O |
| Reactions | OSR0349 OSR0354 |
| Pathways | |
|---|---|
| KEGG | rn00363 rn01120 |
| Database Links | |
|---|---|
| KEGG | C18215 |
| Pubchem Compound | 13542891 |
| Pubchem Substance | 103061397 |