RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0930 |
| Common Name | trans-zeatin |
| Formula | C10H12N5O |
| Formula at pH 7.2 (Predicted) | C10H13N5O |
| Molecular Weight | 218.238 |
| Structure |  |
| SMILES | CC(=CCNC1=NC=NC2=C1NC=N2)CO |
| Reactions | OSR0414 OSR0758 OSR0871 OSR0913 OSR1492 OSR1584 OSR1586 OSR1587 OSR2240 |
| Pathways | |
|---|---|
| Metacyc | PWY-2681 PWY-2902 PWY-2881 PWY-2901 PWY-2841 |
| Database Links | |
|---|---|
| Gramene | CPD-4210 |