RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0932 |
| Common Name | 2-C-Methyl-D-erythritol 2,4-cyclodiphosphate |
| Synonyms Names | 3-Methyl-1,2,3,4-tetrahydroxybutane-1,3-cyclic bisphosphate |
| Formula | C5H12O9P2 |
| Formula at pH 7.2 (Predicted) | C5H10O9P22- |
| Molecular Weight | 278.091 |
| Structure |  |
| SMILES | CC1(CO)(C(O)COP(=O)(O)OP(O)(O1)=O) |
| Reactions | OSR1728 OSR2174 OSR2389 |
| Pathways | |
|---|---|
| KEGG | rn00900 rn01100 rn01110 |
| Metacyc | NONMEVIPP-PWY |
| Database Links | |
|---|---|
| KEGG | C11453 |
| ChEBI | 18425 |