RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0934 |
| Common Name | L-Fucose 1-phosphate |
| Synonyms Names | 6-Deoxy-L-galactose 1-phosphate ;beta-L-Fucose 1-phosphate |
| Formula | C6H13O8P |
| Formula at pH 7.2 (Predicted) | C6H11O8P2- |
| Molecular Weight | 244.136 |
| Structure |  |
| SMILES | C1(C(O)C(O)C(O)C(C)O1)(OP(O)(=O)O) |
| Reactions | OSR0356 OSR1173 OSR1179 |
| Pathways | |
|---|---|
| KEGG | rn00051 rn00520 rn01100 |
| Database Links | |
|---|---|
| KEGG | C02985 |
| ChEBI | 28319 |
| Pubchem Compound | 65369 |
| Pubchem Substance | 5894 |