RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0937 |
| Common Name | Deoxyuridine |
| Synonyms Names | 2-Deoxyuridine ;2'-Deoxyuridine |
| Formula | C9H12N2O5 |
| Formula at pH 7.2 (Predicted) | C9H12N2O5 |
| Molecular Weight | 228.202 |
| Structure |  |
| SMILES | c1(n(c(=O)[nH]c(c1)=O)C2(OC(C(C2)O)CO)) |
| Reactions | OSR0455 OSR0534 OSR1289 |
| Pathways | |
|---|---|
| KEGG | rn00240 |
| Metacyc | PWY0-181 DRIBOPMET-PWY |
| Database Links | |
|---|---|
| KEGG | C00526 |
| ChEBI | 16450 |