RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0938 |
| Common Name | 2'-Deoxyribonucleoside diphosphate |
| Synonyms Names | C04232 |
| Formula | C5H11O9P2R |
| Formula at pH 7.2 (Predicted) | C5H9O9P2R2- |
| Structure |  |
| SMILES | OC1CC(OC1CO[P](O)(=O)O[P](O)(O)=O)[R] |
| Reactions | OSR1112 OSR2336 OSR2398 |
| Pathways | |
|---|---|
| KEGG | rn00480 rn01100 |
| Database Links | |
|---|---|
| KEGG | C04232 |
| Pubchem Substance | 6901 |