RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0940 |
| Common Name | S-Methyl-5-thio-D-ribose 1-phosphate |
| Synonyms Names | S-Methyl-5-thio-alpha-D-ribose 1-phosphate ;S-Methyl-5-thio-5-deoxy-D-ribose 1-phosphate |
| Formula | C6H13O7PS |
| Formula at pH 7.2 (Predicted) | C6H11O7PS2- |
| Molecular Weight | 260.202 |
| Structure |  |
| SMILES | C1(OC(CSC)C(O)C(O)1)(OP(O)(=O)O) |
| Reactions | OSR0363 OSR2268 |
| Pathways | |
|---|---|
| KEGG | rn00270 rn01100 |
| Metacyc | PWY-4361 |
| Database Links | |
|---|---|
| Gramene | CPD-444 |
| KEGG | C04188 |
| ChEBI | 27859 |