RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0960 |
| Common Name | Sinapyl alcohol |
| Synonyms Names | Sinapoyl alcohol |
| Formula | C11H14O4 |
| Formula at pH 7.2 (Predicted) | C11H14O4 |
| Molecular Weight | 210.226 |
| Structure |  |
| SMILES | C(O)C=Cc1(cc(OC)c(O)c(c1)OC) |
| Reactions | OSR1063 OSR2015 |
| Pathways | |
|---|---|
| KEGG | rn00940 rn01100 rn01110 |
| Metacyc | PWY-361 |
| Database Links | |
|---|---|
| KEGG | C02325 |
| ChEBI | 28813 |
| Pubchem Compound | 5280507 |
| Pubchem Substance | 5377 |