RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0961 |
| Common Name | 3,4',5-Trihydroxystilbene |
| Synonyms Names | Resveratrol |
| Formula | C14H12O3 |
| Formula at pH 7.2 (Predicted) | C14H12O3 |
| Molecular Weight | 228.243 |
| Structure |  |
| SMILES | c1(c(cc(O)cc(O)1)C=Cc2(ccc(O)cc2)) |
| Reactions | OSR0413 OSR2673 |
| Pathways | |
|---|---|
| KEGG | rn00945 rn01110 |
| Database Links | |
|---|---|
| Gramene | CPD-83 |
| KEGG | C03582 |
| ChEBI | 27881 |
| Pubchem Compound | 445154 |
| Pubchem Substance | 6374 |