RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0962 |
| Common Name | daidzein |
| Formula | C15H10O4 |
| Formula at pH 7.2 (Predicted) | C15H9O4- |
| Molecular Weight | 254.242 |
| Structure |  |
| SMILES | Oc1ccc(cc1)c1coc2c(c1=O)ccc(c2)O |
| Reactions | OSR0460 OSR1354 OSR1364 OSR1610 |
| Pathways | |
|---|---|
| KEGG | rn00943 |
| Metacyc | PWY-2321 PWY-2861 PWY-2343 PWY-2904 PWY-2345 PWY-2701 PWY-2561 |